For research use only. Not for therapeutic Use.
3-Ethoxy-2-methyl-3-oxopropanoic acid is an α-keto acid characterized by an ethoxy group at the 3-position and a methyl group at the 2-position of the propanoic acid chain. This compound is significant in organic synthesis and medicinal chemistry, serving as an intermediate for various bioactive molecules. The presence of both the ethoxy and keto functionalities enhances its reactivity and solubility, facilitating further chemical transformations. Its unique structure allows for versatile modifications, making it valuable in drug development and synthetic applications.
| CAS Number | 2985-33-3 |
| Molecular Formula | C6H10O4 |
| Purity | ≥95% |
| IUPAC Name | 3-ethoxy-2-methyl-3-oxopropanoic acid |
| InChI | InChI=1S/C6H10O4/c1-3-10-6(9)4(2)5(7)8/h4H,3H2,1-2H3,(H,7,8) |
| InChIKey | REGOCDRDNZNRMC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |