For research use only, not for therapeutic use.
3-(Dimethylamino)propyl methacrylate (Cat.No:L004164) is a crucial compound in polymer chemistry. Its unique structure, combining a methacrylate group with a dimethylaminoalkyl moiety, imparts specialized reactivity. This monomer is widely used in the synthesis of cationic polymers with applications in industries like adhesives and coatings. Its versatile nature and specific attributes make it a key component in the development of advanced materials, emphasizing its significance in contemporary chemical research and industrial applications.
Catalog Number | L004164 |
CAS Number | 20602-77-1 |
Molecular Formula | C9H17NO2 |
Purity | ≥95% |
IUPAC Name | 3-(dimethylamino)propyl 2-methylprop-2-enoate |
InChI | InChI=1S/C9H17NO2/c1-8(2)9(11)12-7-5-6-10(3)4/h1,5-7H2,2-4H3 |
InChIKey | WWJCRUKUIQRCGP-UHFFFAOYSA-N |
SMILES | CC(=C)C(=O)OCCCN(C)C |