Home
>
Chemical Reagents>Heterocyclic Building Blocks> 3-(Dimethylamino)-2-(1-(phenylsulfonyl)-1H-indole-2-carbonyl)acrylonitrile
For research use only. Not for therapeutic Use.
3-(Dimethylamino)-2-(1-(phenylsulfonyl)-1H-indole-2-carbonyl)acrylonitrile(CAT: L018549) is a sophisticated compound designed for advanced pharmaceutical and chemical research. Its unique structure, featuring a dimethylamino group, acrylonitrile functionality, and a phenylsulfonyl-indole moiety, offers versatility in synthetic chemistry and drug discovery. This compound is particularly valuable in the development of biologically active molecules, including enzyme inhibitors and receptor modulators. Its reactive sites enable diverse chemical modifications, making it suitable for creating novel derivatives. With high purity and consistent performance, 3-(Dimethylamino)-2-(1-(phenylsulfonyl)-1H-indole-2-carbonyl)acrylonitrile is a reliable tool for exploring innovative pathways in medicinal and materials chemistry.
| CAS Number | 1265231-91-1 |
| Molecular Formula | C20H17N3O3S |
| Purity | ≥95% |
| IUPAC Name | (E)-2-[1-(benzenesulfonyl)indole-2-carbonyl]-3-(dimethylamino)prop-2-enenitrile |
| InChI | InChI=1S/C20H17N3O3S/c1-22(2)14-16(13-21)20(24)19-12-15-8-6-7-11-18(15)23(19)27(25,26)17-9-4-3-5-10-17/h3-12,14H,1-2H3/b16-14+ |
| InChIKey | OQLIYMMRFFMCEJ-JQIJEIRASA-N |
| SMILES | CN(C)/C=C(\C#N)/C(=O)C1=CC2=CC=CC=C2N1S(=O)(=O)C3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |