3-Diethylaminopropylamine (Cat No.:M069906) is a versatile organic compound utilized in numerous chemical processes and industrial applications. Its molecular structure comprises a propylamine chain with a diethylamino group attached, imparting both basic and nucleophilic properties. DEAPA serves as a crucial building block in the synthesis of various chemicals, including pharmaceuticals, agrochemicals, and surfactants. Additionally, it finds utility as a catalyst in polymerization reactions and as a corrosion inhibitor in metal treatments.
| Catalog Number | M069906 |
| CAS Number | 104-78-9 |
| Molecular Formula | C7H18N2 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | N',N'-diethylpropane-1,3-diamine |
| InChI | InChI=1S/C7H18N2/c1-3-9(4-2)7-5-6-8/h3-8H2,1-2H3 |
| InChIKey | QOHMWDJIBGVPIF-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCN |
