For research use only. Not for therapeutic Use.
3-Cyclopropyl-3-oxopropanoic acid methyl ester (Cat No.: R047058) is an organic compound featuring a cyclopropyl group and a β-keto ester moiety, with the molecular formula C₇H₁₀O₄. It serves as a versatile intermediate in organic synthesis, particularly in pharmaceutical and agrochemical development. The cyclopropyl ring introduces ring strain and lipophilicity, influencing biological activity and reactivity. Its β-keto ester structure allows for enolate formation, enabling various C–C bond-forming reactions. This compound is often used in building complex molecules through alkylation, condensation, or heterocycle formation pathways.
CAS Number | 32249-35-7 |
Synonyms | Methyl 3-Cyclopropyl-3-oxopropionate; Methyl 2-(Cyclopropylcarbonyl)acetate; β-Oxo-cyclopropanepropanoic Acid Methyl Ester; |
Molecular Formula | C7H10O3 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | methyl 3-cyclopropyl-3-oxopropanoate |
InChI | InChI=1S/C7H10O3/c1-10-7(9)4-6(8)5-2-3-5/h5H,2-4H2,1H3 |
InChIKey | RIJWDPRXCXJDPK-UHFFFAOYSA-N |
SMILES | COC(=O)CC(=O)C1CC1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |