For research use only. Not for therapeutic Use.
3-Cyanobenzylamine(Cat No.:R055557)is an aromatic amine featuring a benzene ring substituted with a cyano group at the meta (3-) position and a primary aminomethyl group on the benzylic carbon. This bifunctional compound is widely used as an intermediate in pharmaceutical and agrochemical synthesis. The cyano group serves as a versatile handle for further transformations into amides, carboxylic acids, or heterocycles, while the amine group allows for coupling reactions, reductive aminations, or urea formation. Its structure supports medicinal chemistry efforts aimed at generating bioactive scaffolds with improved potency and selectivity.
| CAS Number | 10406-24-3 |
| Synonyms | 3-(Aminomethyl)benzonitrile; α-Amino-m-tolunitrile; 1-Aminomethyl-3-cyanobenzene; 3-(Aminomethyl)benzonitrile; m-Cyanobenzylamine; |
| Molecular Formula | C8H8N2 |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | 3-(aminomethyl)benzonitrile |
| InChI | InChI=1S/C8H8N2/c9-5-7-2-1-3-8(4-7)6-10/h1-4H,5,9H2 |
| InChIKey | XFKPORAVEUOIRF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C#N)CN |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |