For research use only. Not for therapeutic Use.
3-(Chlorosulfonyl)-4-methylbenzoyl chloride(Cat No.:L007577), is a chemical compound featuring a benzoyl chloride group at the 4-position of a methyl-substituted benzene ring, with a chlorosulfonyl group attached at the 3-position. This unique molecular structure provides high reactivity and selectivity in various chemical reactions. Scientists and chemists utilize this compound as a versatile reagent in organic synthesis, enabling the introduction of specific functional groups into organic molecules. Its applications extend across the fields of medicinal chemistry, agrochemicals, and materials science, where precise chemical modifications are crucial.
CAS Number | 547739-67-3 |
Molecular Formula | C8H6Cl2O3S |
Purity | ≥95% |
IUPAC Name | 3-chlorosulfonyl-4-methylbenzoyl chloride |
InChI | InChI=1S/C8H6Cl2O3S/c1-5-2-3-6(8(9)11)4-7(5)14(10,12)13/h2-4H,1H3 |
InChIKey | BSHLCKNAKRLVSS-UHFFFAOYSA-N |
SMILES | CC1=C(C=C(C=C1)C(=O)Cl)S(=O)(=O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |