For research use only. Not for therapeutic Use.
3-Chlorodiphenylamine (Cat.No:R051249) is a chemical compound used in various industrial applications, including as an intermediate in the synthesis of dyes and pharmaceuticals. It possesses a chlorinated diphenylamine structure and can serve as a valuable building block in organic chemistry for the creation of diverse molecules with specific properties.
| CAS Number | 101-17-7 |
| Synonyms | 3-Chloro-N-phenyl-benzenamine; N-(3-Chlorophenyl)-N-phenylamine; N-(3-Chlorophenyl)aniline; N-(m-Chlorophenyl)aniline; Phenyl(m-chlorophenyl)amine; m-Chlorodiphenylamine |
| Molecular Formula | C12H10ClN |
| Purity | ≥95% |
| Target | Potassium Channel |
| Storage | -20°C |
| IUPAC Name | 3-chloro-N-phenylaniline |
| InChI | InChI=1S/C12H10ClN/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,14H |
| InChIKey | OHHIBZKYXJDQEU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC(=CC=C2)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
