For research use only. Not for therapeutic Use.
3-Chloro-5-iodopyrazin-2-amine(CAT: L032149) is a high-purity halogenated heterocyclic compound featuring a chloro and iodo substituent on a pyrazine ring with an amino group at the 2-position. This versatile molecule serves as a key building block in pharmaceutical and chemical research, particularly for the synthesis of bioactive compounds and complex heterocyclic frameworks. Its dual halogenation allows for targeted functionalization via cross-coupling reactions (e.g., Suzuki or Buchwald-Hartwig), facilitating the development of novel therapeutic candidates and advanced materials. 3-Chloro-5-iodopyrazin-2-amine offers excellent stability and reactivity, making it an essential intermediate for precision-driven applications in medicinal chemistry and organic synthesis.
CAS Number | 1252597-70-8 |
Molecular Formula | C4H3ClIN3 |
Purity | ≥95% |
IUPAC Name | 3-chloro-5-iodopyrazin-2-amine |
InChI | InChI=1S/C4H3ClIN3/c5-3-4(7)8-1-2(6)9-3/h1H,(H2,7,8) |
InChIKey | KVGKDDCJSHJYCS-UHFFFAOYSA-N |
SMILES | C1=C(N=C(C(=N1)N)Cl)I |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |