For research use only. Not for therapeutic Use.
3-Chloro-5-fluoro-2-methylaniline(Cat No.:L033050)is a halogenated aromatic amine used in organic synthesis and pharmaceutical research. The compound features a benzene ring substituted with a chlorine atom at the 3-position, a fluorine atom at the 5-position, and a methyl group at the 2-position, along with an amino group. This structure provides unique reactivity, making it a valuable intermediate in the synthesis of complex molecules, particularly in the development of pharmaceuticals and agrochemicals. Its functional groups allow for versatile chemical modifications, making it essential for researchers focused on drug discovery and advanced synthetic chemistry.
Catalog Number | L033050 |
CAS Number | 886761-87-1 |
Molecular Formula | C7H7ClFN |
Purity | ≥95% |
IUPAC Name | 3-chloro-5-fluoro-2-methylaniline |
InChI | InChI=1S/C7H7ClFN/c1-4-6(8)2-5(9)3-7(4)10/h2-3H,10H2,1H3 |
InChIKey | WAPXWUPJSPGPSS-UHFFFAOYSA-N |
SMILES | CC1=C(C=C(C=C1Cl)F)N |