For research use only. Not for therapeutic Use.
3-Chloro-4-(dichloromethyl)-5-hydroxy-2(5H)-furanone (Cat.No:R046948) is a chemical compound with potential relevance in the field of chemistry and industry. Its structure consists of a furanone ring with chlorinated methyl groups. The compound’s exact applications and significance may vary across different sectors, including research and manufacturing processes.
CAS Number | 77439-76-0 |
Synonyms | MX; MX (Bacterial Mutagen); Mutagen X; |
Molecular Formula | C5H3Cl3O3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 4-chloro-3-(dichloromethyl)-2-hydroxy-2H-furan-5-one |
InChI | InChI=1S/C5H3Cl3O3/c6-2-1(3(7)8)4(9)11-5(2)10/h3-4,9H |
InChIKey | WNTRMRXAGJOLCU-UHFFFAOYSA-N |
SMILES | C1(C(=C(C(=O)O1)Cl)C(Cl)Cl)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |