For research use only. Not for therapeutic Use.
3-Chloro-4-[(3-chlorophenyl)methoxy]benzoic Acid(Cat No.:L007741), is a chemical compound used in pharmaceutical and research applications. This compound belongs to the class of benzoic acids and derivatives, characterized by a benzene ring substituted with a carboxylic acid group and a chloro-methoxyphenyl group. Researchers utilize this compound in medicinal chemistry for its potential biological activities or as a building block for the synthesis of more complex molecules.
| CAS Number | 1002970-32-2 |
| Molecular Formula | C14H10Cl2O3 |
| Purity | ≥95% |
| IUPAC Name | 3-chloro-4-[(3-chlorophenyl)methoxy]benzoic acid |
| InChI | InChI=1S/C14H10Cl2O3/c15-11-3-1-2-9(6-11)8-19-13-5-4-10(14(17)18)7-12(13)16/h1-7H,8H2,(H,17,18) |
| InChIKey | YZOMEFGASCKZMH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)COC2=C(C=C(C=C2)C(=O)O)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |