For research use only. Not for therapeutic Use.
3-Chloro-2-fluoro-5-(trifluoromethyl)anisole(CAT: L015034) is a high-purity aromatic compound featuring a trifluoromethyl group, chlorine, and fluorine substituents on an anisole backbone. This versatile molecule is widely utilized as an intermediate in pharmaceutical and agrochemical synthesis, particularly in the development of bioactive compounds, such as enzyme inhibitors and advanced materials. Its unique electronic and steric properties make it suitable for diverse chemical transformations, including cross-coupling and nucleophilic substitution reactions. 3-Chloro-2-fluoro-5-(trifluoromethyl)anisole supports innovative research in medicinal chemistry, fine chemical production, and material science applications.
CAS Number | 261763-01-3 |
Molecular Formula | C8H5ClF4O |
Purity | ≥95% |
IUPAC Name | 1-chloro-2-fluoro-3-methoxy-5-(trifluoromethyl)benzene |
InChI | InChI=1S/C8H5ClF4O/c1-14-6-3-4(8(11,12)13)2-5(9)7(6)10/h2-3H,1H3 |
InChIKey | HROFCMRAPMYLRR-UHFFFAOYSA-N |
SMILES | COC1=C(C(=CC(=C1)C(F)(F)F)Cl)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |