For research use only. Not for therapeutic Use.
3-Chloro-1H-indazole-7-carboxylic acid(CAT: L048836) is a high-purity heterocyclic compound widely utilized in pharmaceutical and chemical research. Featuring a 3-chloro substitution on the indazole core and a carboxylic acid functional group at the 7-position, it serves as a critical intermediate in the synthesis of biologically active molecules. This compound is instrumental in the development of kinase inhibitors, anti-inflammatory agents, and other therapeutic candidates. With exceptional stability and compatibility in diverse reaction conditions, 3-Chloro-1H-indazole-7-carboxylic acid is a reliable choice for researchers aiming to advance medicinal chemistry and drug discovery endeavors.
| CAS Number | 1556131-93-1 |
| Molecular Formula | C8H5ClN2O2 |
| Purity | ≥95% |
| IUPAC Name | 3-chloro-2H-indazole-7-carboxylic acid |
| InChI | InChI=1S/C8H5ClN2O2/c9-7-4-2-1-3-5(8(12)13)6(4)10-11-7/h1-3H,(H,10,11)(H,12,13) |
| InChIKey | AHXDZMSQYSBKBO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NN=C2C(=C1)C(=O)O)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |