For research use only. Not for therapeutic Use.
3-Carboxy-2,2,5,5-tetramethylpyrrolidinyl-1-oxy (Cat No.: R001346) is a stable nitroxide radical commonly used as a spin label and redox probe in electron paramagnetic resonance (EPR) spectroscopy. Its carboxyl group enhances water solubility, making it suitable for biological and biochemical applications. This compound is frequently used to study molecular dynamics, oxygen concentration, and redox status in biological systems. Due to its stability and paramagnetic properties, it also serves as a contrast agent in magnetic resonance imaging (MRI) research.
| CAS Number | 2154-68-9 |
| Synonyms | 2,2,5,5-Tetramethyl-3-carboxypyrrolidine-N-oxyl; 3-Carboxy-PROXYL; DL-3-Carboxy-2,2,5,5-tetramethyl-1-pyrrolidinyloxyl; NSC 158842; PCA; |
| Molecular Formula | C9H16NO3 |
| Purity | ≥95% |
| Storage | 3 years -20C powder |
| InChI | InChI=1S/C9H16NO3/c1-8(2)5-6(7(11)12)9(3,4)10(8)13/h6H,5H2,1-4H3,(H,11,12) |
| InChIKey | GEPIUTWNBHBHIO-UHFFFAOYSA-N |
| SMILES | CC1(CC(C(N1[O])(C)C)C(=O)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
