For research use only. Not for therapeutic Use.
3-Bromopiperidine-2,6-dione(CAT: L029399) is a versatile heterocyclic compound featuring a piperidine-2,6-dione core substituted with a bromine atom at the 3-position. This brominated derivative serves as a valuable synthetic intermediate in medicinal chemistry, agrochemical development, and materials science. Its reactive bromine atom enables diverse functional group substitutions through nucleophilic substitution or cross-coupling reactions, facilitating the synthesis of complex molecules. The compound is often employed in the preparation of pharmacologically active agents, including alkaloid analogs and heteroaryl derivatives, as well as in structure–activity relationship (SAR) studies.
| CAS Number | 62595-74-8 |
| Molecular Formula | C5H6BrNO2 |
| Purity | ≥95% |
| IUPAC Name | 3-bromopiperidine-2,6-dione |
| InChI | InChI=1S/C5H6BrNO2/c6-3-1-2-4(8)7-5(3)9/h3H,1-2H2,(H,7,8,9) |
| InChIKey | RYSICGXZRVMXDP-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |