For research use only. Not for therapeutic Use.
3-(Bromomethyl)benzaldehyde(Cat No.:L015428)is an aromatic compound featuring a benzene ring substituted with a bromomethyl group at the 3-position and an aldehyde group at the 1-position. This bifunctional molecule serves as a valuable intermediate in organic synthesis, particularly for constructing more complex aromatic compounds. The bromomethyl group is highly reactive toward nucleophilic substitution, allowing the introduction of various functional groups, while the aldehyde group enables condensation reactions, such as Schiff base formation. It is commonly used in the synthesis of pharmaceuticals, agrochemicals, and specialty materials, offering versatility in multistep reaction sequences.
| CAS Number | 82072-23-9 |
| Molecular Formula | C8H7BrO |
| Purity | ≥95% |
| IUPAC Name | 3-(bromomethyl)benzaldehyde |
| InChI | InChI=1S/C8H7BrO/c9-5-7-2-1-3-8(4-7)6-10/h1-4,6H,5H2 |
| InChIKey | OEPGAYXSRGROSQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C=O)CBr |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |