For research use only. Not for therapeutic Use.
3-Bromo-6-methyl-5-nitro-1H-indazole(Cat No.:L041222)is a heterocyclic compound utilized as an intermediate in the synthesis of pharmaceuticals and bioactive molecules. This compound features a bromine atom at the 3-position, a methyl group at the 6-position, and a nitro group at the 5-position on the indazole ring, making it a versatile building block for creating complex chemical structures. It is particularly valuable in drug discovery, where it contributes to the development of compounds targeting specific biological pathways. Its reactivity and structural diversity make it essential in medicinal chemistry.
CAS Number | 1000343-58-7 |
Molecular Formula | C8H6BrN3O2 |
Purity | ≥95% |
IUPAC Name | 3-bromo-6-methyl-5-nitro-2H-indazole |
InChI | InChI=1S/C8H6BrN3O2/c1-4-2-6-5(8(9)11-10-6)3-7(4)12(13)14/h2-3H,1H3,(H,10,11) |
InChIKey | GIOGUISZUYCHAK-UHFFFAOYSA-N |
SMILES | CC1=CC2=NNC(=C2C=C1[N+](=O)[O-])Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |