For research use only. Not for therapeutic Use.
3-Bromo-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole is a heterocyclic compound used in pharmaceutical research and organic synthesis. Its fused pyrrolo-pyrazole ring system, combined with a bromine atom at the 3-position, offers unique reactivity, making it a valuable intermediate for the development of bioactive molecules. This compound is often utilized in the design of kinase inhibitors, enzyme modulators, and other therapeutic agents. Its structural versatility allows for further functionalization, contributing to advancements in medicinal chemistry and drug discovery.
| CAS Number | 174790-35-3 |
| Molecular Formula | C6H7BrN2 |
| Purity | ≥95% |
| Storage | Store at +4°C |
| IUPAC Name | 3-bromo-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole |
| InChI | InChI=1S/C6H7BrN2/c7-5-4-8-9-3-1-2-6(5)9/h4H,1-3H2 |
| InChIKey | ASLSBGAOXZIHHP-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=NN2C1)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |