For research use only. Not for therapeutic Use.
3-Bromo-5-hydroxypicolinonitrile(CAT: L016314) is a heterocyclic compound derived from picolinonitrile, featuring a bromine atom at the 3-position, a hydroxyl group (-OH) at the 5-position, and a nitrile group (-CN) attached to the pyridine ring. This structure combines both electron-withdrawing (nitrile) and electron-donating (hydroxyl) groups, which can influence the compound’s reactivity and interactions in biological systems. It is commonly used as a building block in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. The bromine atom allows for further functionalization through cross-coupling reactions, making it useful in constructing more complex molecules for drug design or material science applications.
| CAS Number | 1805487-25-5 |
| Molecular Formula | C6H3BrN2O |
| Purity | ≥95% |
| IUPAC Name | 3-bromo-5-hydroxypyridine-2-carbonitrile |
| InChI | InChI=1S/C6H3BrN2O/c7-5-1-4(10)3-9-6(5)2-8/h1,3,10H |
| InChIKey | BDDVKWWUFWQUEB-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |