For research use only. Not for therapeutic Use.
3-Bromo-4-methylphenol(CAT: L044790) is a high-purity aromatic compound featuring a bromine atom and a methyl group substituted on a phenol ring. This versatile structure makes it an essential intermediate in pharmaceutical research, agrochemical development, and fine chemical synthesis. The hydroxyl group provides reactivity for further derivatization, while the bromine allows for cross-coupling reactions, such as Suzuki-Miyaura or Buchwald-Hartwig couplings, enabling the synthesis of complex molecules. 3-Bromo-4-methylphenol is widely used for designing bioactive compounds, small-molecule inhibitors, and functionalized materials, offering stability, reliability, and precision in both academic and industrial research applications.
| CAS Number | 60710-39-6 |
| Molecular Formula | C7H7BrO |
| Purity | ≥95% |
| IUPAC Name | 3-bromo-4-methylphenol |
| InChI | InChI=1S/C7H7BrO/c1-5-2-3-6(9)4-7(5)8/h2-4,9H,1H3 |
| InChIKey | GMZKNRDHSHYMHG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)O)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |