For research use only. Not for therapeutic Use.
3-Bromo-4-methylbenzoic acid(Cat No.:L013627)is an aromatic carboxylic acid used as an intermediate in organic synthesis, particularly in pharmaceutical and chemical research. This compound features a bromine atom at the 3-position and a methyl group at the 4-position of the benzoic acid ring, making it valuable for constructing complex molecules. It is commonly employed in the synthesis of bioactive compounds, including potential drug candidates and specialty chemicals. With high purity and reactivity, 3-Bromo-4-methylbenzoic acid plays a crucial role in advancing research in medicinal chemistry and material science.
| CAS Number | 7697-26-9 |
| Molecular Formula | C8H7BrO2 |
| Purity | ≥95% |
| IUPAC Name | 3-bromo-4-methylbenzoic acid |
| InChI | InChI=1S/C8H7BrO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4H,1H3,(H,10,11) |
| InChIKey | ZFJOMUKPDWNRFI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |