For research use only. Not for therapeutic Use.
3-Bromo-4-chloro-5-fluorobenzonitrile(Cat No.:L032670)is a specialized compound used in pharmaceutical research and organic synthesis. Featuring bromine, chlorine, and fluorine substituents on a benzonitrile core, this compound serves as a crucial intermediate in the synthesis of complex molecules, including potential drug candidates. Its halogenated structure provides unique reactivity, making it valuable for selective chemical transformations and modifications. With high purity and consistent quality, this compound is essential for advancing medicinal chemistry and the development of innovative therapeutic agents and other specialized chemical products.
CAS Number | 1357944-86-5 |
Molecular Formula | C7H2BrClFN |
Purity | ≥95% |
IUPAC Name | 3-bromo-4-chloro-5-fluorobenzonitrile |
InChI | InChI=1S/C7H2BrClFN/c8-5-1-4(3-11)2-6(10)7(5)9/h1-2H |
InChIKey | ZTHRAKNXQNIZLZ-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1F)Cl)Br)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |