For research use only. Not for therapeutic Use.
3-Bromo-2,6-dichloro-5-fluoropyridine(Cat No.:M093756) is a halogenated pyridine derivative, distinguished by its bromo, chloro, and fluoro substituents. This compound features a pyridine ring, a basic organic ring structure containing nitrogen, with bromine attached at the 3 positions, chlorine atoms at the 2 and 6 positions, and a fluorine atom at the 5 positions. These halogens significantly enhance its reactivity, making it a valuable intermediate in organic synthesis, particularly in the pharmaceutical industry. Its use includes the synthesis of complex molecules for drug development, leveraging its ability to undergo various chemical reactions due to the presence of multiple reactive halogen atoms.
CAS Number | 152840-66-9 |
Synonyms | 3-Bromo-2,6-dichloro-5-fluoropyridine |
Molecular Formula | C5HBrCl2FN |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | 3-bromo-2,6-dichloro-5-fluoropyridine |
InChI | InChI=1S/C5HBrCl2FN/c6-2-1-3(9)5(8)10-4(2)7/h1H |
InChIKey | ZJKVAKOCZBDQAF-UHFFFAOYSA-N |
SMILES | C1=C(C(=NC(=C1Br)Cl)Cl)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |