For research use only. Not for therapeutic Use.
3-Bromo-2-methoxybenzoic Acid (Cat.No:R028209) is a chemical compound with applications in pharmaceutical and chemical synthesis. It features a bromine-substituted benzene ring with a methoxy group. This compound serves as a building block in organic chemistry, contributing to the creation of diverse molecules for research and industrial purposes.
| CAS Number | 101084-39-3 |
| Synonyms | 3-Bromo-o-anisic Acid; 2-Methoxy-3-bromobenzoic Acid; NSC 76704; 3-Bromoanisic Acid |
| Molecular Formula | C8H7BrO3 |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | 3-bromo-2-methoxybenzoic acid |
| InChI | InChI=1S/C8H7BrO3/c1-12-7-5(8(10)11)3-2-4-6(7)9/h2-4H,1H3,(H,10,11) |
| InChIKey | PIBPHOFXQUUPTM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC=C1Br)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |