For research use only. Not for therapeutic Use.
3-Bromo-2-fluorophenylacetic acid(CAT: L034920) is an aromatic organic compound with both a bromine atom at position 3 and a fluorine atom at position 2 on the phenyl ring, along with an acetic acid functional group. This compound is commonly used as an intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of both bromine and fluorine atoms enhances its reactivity in halogenation and cross-coupling reactions, making it a versatile building block for creating more complex molecules. 3-Bromo-2-fluorophenylacetic acid is valuable in medicinal chemistry, where it can be used in the synthesis of drug candidates or bioactive compounds.
| CAS Number | 1375964-39-8 |
| Molecular Formula | C8H6BrFO2 |
| Purity | ≥95% |
| IUPAC Name | 2-(3-bromo-2-fluorophenyl)acetic acid |
| InChI | InChI=1S/C8H6BrFO2/c9-6-3-1-2-5(8(6)10)4-7(11)12/h1-3H,4H2,(H,11,12) |
| InChIKey | PAWQVTBBRAZDMG-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |