For research use only. Not for therapeutic Use.
3-Bromo-2-(bromomethyl)prop-1-ene (Cat.No:M135024) is a chemical compound used as a reagent in organic synthesis. It contains two bromine atoms and an alkene functional group, making it versatile for various reactions, such as nucleophilic substitution and cross-coupling. This compound serves as a valuable building block in the creation of complex organic molecules.
CAS Number | 15378-31-1 |
Molecular Formula | C4H6Br2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 3-bromo-2-(bromomethyl)prop-1-ene |
InChI | InChI=1S/C4H6Br2/c1-4(2-5)3-6/h1-3H2 |
InChIKey | BDHXXBPPYQRWMC-UHFFFAOYSA-N |
SMILES | C=C(CBr)CBr |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |