For research use only. Not for therapeutic Use.
3-Boc-6-oxo-3-aza-bicyclo[3.1.1]heptane is a bicyclic compound featuring a tert-butyloxycarbonyl (Boc) protective group and an oxo functional group. This structure provides unique chemical properties, making it valuable in organic synthesis and medicinal chemistry. The bicyclic framework is of interest due to its potential as a scaffold for designing biologically active molecules. The Boc group facilitates selective deprotection during synthetic pathways, allowing for the introduction of various functional groups. Research explores its applications in the development of new pharmaceuticals, particularly in the field of neuropharmacology and enzyme inhibition, highlighting its potential in drug discovery.
| CAS Number | 1251013-26-9 |
| Molecular Formula | C11H17NO3 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | tert-butyl 6-oxo-3-azabicyclo[3.1.1]heptane-3-carboxylate |
| InChI | InChI=1S/C11H17NO3/c1-11(2,3)15-10(14)12-5-7-4-8(6-12)9(7)13/h7-8H,4-6H2,1-3H3 |
| InChIKey | HYSWAZRVGXDNQF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CC(C1)C2=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |