For research use only. Not for therapeutic Use.
3-Benzyloxyaniline(CAT: M046470) is an organic compound featuring an aniline (phenylamine) group substituted with a benzyloxy group at the 3rd position on the aromatic ring. This compound is commonly used as a building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its structure, which includes both an amine and an ether functionality, provides versatility for further chemical modifications, making it useful for the preparation of more complex molecules. 3-Benzyloxyaniline is employed in the design of intermediates for heterocyclic compounds, dyes, and polymers, contributing to its importance in medicinal chemistry and material science.
| CAS Number | 1484-26-0 |
| Molecular Formula | C13H13NO |
| Purity | ≥95% |
| Storage | Desiccate at -20C |
| IUPAC Name | 3-phenylmethoxyaniline |
| InChI | InChI=1S/C13H13NO/c14-12-7-4-8-13(9-12)15-10-11-5-2-1-3-6-11/h1-9H,10,14H2 |
| InChIKey | IGPFOKFDBICQMC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |