For research use only, not for therapeutic use.
3-Benzyloxy-5-bromoacetylisoxazole(Cat No.:L003168)is a high-purity heterocyclic compound used in pharmaceutical and chemical research. This molecule features an isoxazole ring with a benzyloxy group at the 3-position and a bromoacetyl group at the 5-position, making it a versatile intermediate in the synthesis of bioactive molecules, including potential drug candidates. Its unique structure allows for selective reactivity in various chemical transformations, such as acylation and cyclization reactions. 3-Benzyloxy-5-bromoacetylisoxazole is essential for precise synthetic applications, contributing to advancements in medicinal chemistry and innovative research.
Catalog Number | L003168 |
CAS Number | 104182-22-1 |
Molecular Formula | C12H10BrNO3 |
Purity | ≥95% |
IUPAC Name | 2-bromo-1-(3-phenylmethoxy-1,2-oxazol-5-yl)ethanone |
InChI | InChI=1S/C12H10BrNO3/c13-7-10(15)11-6-12(14-17-11)16-8-9-4-2-1-3-5-9/h1-6H,7-8H2 |
InChIKey | FRFSVXHASPPWPV-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)COC2=NOC(=C2)C(=O)CBr |