3-Benzyloxy-5-bromoacetylisoxazole

For research use only, not for therapeutic use.

  • CAT Number: L003168
  • CAS Number: 104182-22-1
  • Molecular Formula: C12H10BrNO3
  • Molecular Weight: 296.12
  • Purity: ≥95%
Inquiry Now

3-Benzyloxy-5-bromoacetylisoxazole(Cat No.:L003168)is a high-purity heterocyclic compound used in pharmaceutical and chemical research. This molecule features an isoxazole ring with a benzyloxy group at the 3-position and a bromoacetyl group at the 5-position, making it a versatile intermediate in the synthesis of bioactive molecules, including potential drug candidates. Its unique structure allows for selective reactivity in various chemical transformations, such as acylation and cyclization reactions. 3-Benzyloxy-5-bromoacetylisoxazole is essential for precise synthetic applications, contributing to advancements in medicinal chemistry and innovative research.


Catalog Number L003168
CAS Number 104182-22-1
Molecular Formula C12H10BrNO3
Purity ≥95%
IUPAC Name 2-bromo-1-(3-phenylmethoxy-1,2-oxazol-5-yl)ethanone
InChI InChI=1S/C12H10BrNO3/c13-7-10(15)11-6-12(14-17-11)16-8-9-4-2-1-3-5-9/h1-6H,7-8H2
InChIKey FRFSVXHASPPWPV-UHFFFAOYSA-N
SMILES C1=CC=C(C=C1)COC2=NOC(=C2)C(=O)CBr

Request a Quote