For research use only. Not for therapeutic Use.
3-Benzofurancarboxylic acid, 5-hydroxy- (Cat No.:L007279), also known as Esculin, plays a crucial role in biological and pharmaceutical research. This natural compound is found in the bark of the horse chestnut tree and various other plants. Esculin exhibits antioxidant, anti-inflammatory, and anticoagulant properties. It is widely used in the pharmaceutical industry for its therapeutic potential, especially in treating venous insufficiency. Additionally, it serves as a fluorescent dye for detecting metal ions. Esculin’s diverse applications highlight its significance in both medicinal and analytical chemistry, making it a valuable compound for scientific investigations and medical applications.
CAS Number | 29735-85-1 |
Molecular Formula | C9H6O4 |
Purity | ≥95% |
IUPAC Name | 5-hydroxy-1-benzofuran-3-carboxylic acid |
InChI | InChI=1S/C9H6O4/c10-5-1-2-8-6(3-5)7(4-13-8)9(11)12/h1-4,10H,(H,11,12) |
InChIKey | GWWDURABERRAPL-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1O)C(=CO2)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |