Home
>
Chemical Reagents>Organometallic Reagents> 3-(Aminomethyl)-5-fluorophenylboronic acid hydrochloride
For research use only. Not for therapeutic Use.
3-(Aminomethyl)-5-fluorophenylboronic acid hydrochloride(CAT: L000521) is a chemically important compound used in both pharmaceutical and organic chemistry. Its action method primarily involves its role as a versatile reagent for the synthesis of various compounds. In pharmaceutical chemistry, it serves as a valuable building block for the development of potential drug candidates and bioactive molecules, thanks to its specific structure and the boronic acid group, which can participate in important coupling reactions.
CAS Number | 2377606-87-4 |
Molecular Formula | C7H10BClFNO2 |
Purity | ≥95% |
IUPAC Name | [3-(aminomethyl)-5-fluorophenyl]boronic acid;hydrochloride |
InChI | InChI=1S/C7H9BFNO2.ClH/c9-7-2-5(4-10)1-6(3-7)8(11)12;/h1-3,11-12H,4,10H2;1H |
InChIKey | QTAXXTZMUWNWGS-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |