For research use only. Not for therapeutic Use.
3-Aminocyclobutanone hydrochloride (Cat No.: R028698) is a cyclic amino ketone presented as a stable hydrochloride salt, featuring a four-membered cyclobutanone ring with an amino group at the 3-position. It is commonly used as a versatile intermediate in organic synthesis, particularly in the preparation of nitrogen-containing heterocycles and pharmaceutical candidates. The strained ring system and reactive functional groups allow for diverse chemical transformations. Its hydrochloride form enhances water solubility and stability, making it suitable for use in medicinal chemistry and biochemical research.
| CAS Number | 1035374-20-9 |
| Synonyms | 3-Aminocyclobutan-1-one Hydrochloride |
| Molecular Formula | C4H8ClNO |
| Purity | ≥95% |
| Storage | Store at -20C |
| IUPAC Name | 3-aminocyclobutan-1-one;hydrochloride |
| InChI | InChI=1S/C4H7NO.ClH/c5-3-1-4(6)2-3;/h3H,1-2,5H2;1H |
| InChIKey | NEQHFBUOBOTJDV-UHFFFAOYSA-N |
| SMILES | C1C(CC1=O)N.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |