For research use only. Not for therapeutic Use.
3-Amino-6-methoxypyridazine (Cat.No:M011365) is a chemical compound utilized as a versatile building block in organic synthesis. Its pyridazine ring structure with an amino and a methoxy group makes it valuable for constructing more complex molecules. Researchers employ it in medicinal chemistry and agrochemical research for designing novel compounds with desired properties.
CAS Number | 7252-84-8 |
Molecular Formula | C5H7N3O |
Purity | ≥95% |
IUPAC Name | 6-methoxypyridazin-3-amine |
InChI | InChI=1S/C5H7N3O/c1-9-5-3-2-4(6)7-8-5/h2-3H,1H3,(H2,6,7) |
InChIKey | YPWBPONDYDVMLX-UHFFFAOYSA-N |
SMILES | COC1=NN=C(C=C1)N |
Reference | <p> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |