For research use only. Not for therapeutic Use.
3-Amino-5-(ethoxycarbonyl)benzoic acid(Cat No.:L032202)is an important intermediate in organic synthesis, particularly in the development of pharmaceutical compounds. It features an amino group at the 3-position and an ethoxycarbonyl (ester) group at the 5-position on the benzoic acid ring, offering significant reactivity for creating complex molecules. This compound is valuable for synthesizing biologically active substances, including potential drug candidates, where precise structural modifications are essential. Its versatile functional groups make it a crucial building block for researchers focused on medicinal chemistry and advanced chemical synthesis.
| CAS Number | 1312425-07-2 |
| Molecular Formula | C10H11NO4 |
| Purity | ≥95% |
| IUPAC Name | 3-amino-5-ethoxycarbonylbenzoic acid |
| InChI | InChI=1S/C10H11NO4/c1-2-15-10(14)7-3-6(9(12)13)4-8(11)5-7/h3-5H,2,11H2,1H3,(H,12,13) |
| InChIKey | FWJOEEOPJUMDND-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=C1)C(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |