For research use only. Not for therapeutic Use.
3-Amino-1,2-propanediol(Cat No.:R060267), also known as serinol, is a small, hydrophilic organic compound with the molecular formula C3H9NO2. It features two hydroxyl groups on the 1 and 2 positions and an amino group on the 3-position of a propane backbone. This tri-functional molecule serves as a versatile intermediate in the synthesis of pharmaceuticals, surfactants, and biologically active molecules. Its structure allows for participation in hydrogen bonding and various chemical modifications. 3-Amino-1,2-propanediol is also used in peptide synthesis and biochemical research due to its water solubility and structural similarity to natural amino alcohols.
CAS Number | 616-30-8 |
Synonyms | (RS)-3-Amino-1,2-propanediol; (±)-3-Amino-1,2-dihydroxypropane; (±)-3-Amino-1,2-propanediol; 1,2-Dihydroxy-3-aminopropane; 1-Amino-2,3-dihydroxypropane; 1-Amino-2,3-propanediol; 1-Aminoglycerol; 2,3-Dihydroxypropan-1-amine; 2,3-Dihydroxypropanamine; |
Molecular Formula | C3H9NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-aminopropane-1,2-diol |
InChI | InChI=1S/C3H9NO2/c4-1-3(6)2-5/h3,5-6H,1-2,4H2 |
InChIKey | KQIGMPWTAHJUMN-UHFFFAOYSA-N |
SMILES | C(C(CO)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |