3-Amino-1-phenylpropan-1-one hydrochloride(CAT: L000277) is a compound of importance in pharmaceutical chemistry. This chemical is utilized as a key intermediate in the synthesis of pharmaceutical compounds. Its action method involves serving as a fundamental building block in the creation of drug candidates. In the realm of drug discovery and development, it plays a crucial role in the design and synthesis of compounds with potential therapeutic applications.
Catalog Number | L000277 |
CAS Number | 7495-58-1 |
Molecular Formula | C9H12ClNO |
Purity | 95% |
IUPAC Name | 3-amino-1-phenylpropan-1-one;hydrochloride |
InChI | InChI=1S/C9H11NO.ClH/c10-7-6-9(11)8-4-2-1-3-5-8;/h1-5H,6-7,10H2;1H |
InChIKey | SRKNYRPFYRZTOM-UHFFFAOYSA-N |