For research use only. Not for therapeutic Use.
3-Allyl-1-methyl-1H-imidazol-3-ium thiocyanate(CAT: L000552) holds significance in the field of organic chemistry, specifically in the synthesis of various organic compounds. This chemical plays a crucial role as an intermediate in the production of specialty chemicals and pharmaceuticals. It’s utilized to introduce imidazolium and thiocyanate functional groups into molecules, contributing to the development of bioactive compounds and fine chemicals.
| CAS Number | 861908-19-2 |
| Molecular Formula | C8H11N3S |
| Purity | ≥95% |
| IUPAC Name | 1-methyl-3-prop-2-enylimidazol-1-ium;thiocyanate |
| InChI | InChI=1S/C7H11N2.CHNS/c1-3-4-9-6-5-8(2)7-9;2-1-3/h3,5-7H,1,4H2,2H3;3H/q+1;/p-1 |
| InChIKey | CPLXMRDZMKVGGR-UHFFFAOYSA-M |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |