Home
>
Chemical Reagents>Organic Building Blocks>
>
3-((((9H-Fluoren-9-yl)methoxy)carbonyl)(propyl)amino)propanoic acid
3-((((9H-Fluoren-9-yl)methoxy)carbonyl)(propyl)amino)propanoic acid(CAT: L000130) is a crucial compound in the realm of organic chemistry and pharmaceutical research. This chemical demonstrates a multifaceted action method by targeting specific enzymes or receptors, making it a promising candidate for drug development. In the pharmaceutical sector, it is extensively utilized for the synthesis of prodrugs and drug conjugates, especially in the design of innovative therapies for various medical conditions.
Catalog Number | L000130 |
CAS Number | 2171909-89-8 |
Molecular Formula | C21H23NO4 |
Purity | 95% |
IUPAC Name | 3-[9H-fluoren-9-ylmethoxycarbonyl(propyl)amino]propanoic acid |
InChI | InChI=1S/C21H23NO4/c1-2-12-22(13-11-20(23)24)21(25)26-14-19-17-9-5-3-7-15(17)16-8-4-6-10-18(16)19/h3-10,19H,2,11-14H2,1H3,(H,23,24) |
InChIKey | FDDVCHDTTFLIAA-UHFFFAOYSA-N |