Home
>
Chemical Reagents>Organic Building Blocks> 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(trifluoromethyl)phenyl]propanoic Acid
For research use only. Not for therapeutic Use.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(trifluoromethyl)phenyl]propanoic Acid(Cat No.:L007277), is a significant compound in medicinal chemistry. This molecule, characterized by a fluorene-derived structure attached to a propanoic acid moiety, is crucial in drug discovery efforts. Researchers employ it as a key intermediate or building block in the synthesis of potential pharmaceutical agents. Its unique structure and reactivity make it valuable for designing analogs and derivatives with improved biological activity and pharmacokinetic properties. This compound’s synthesis and exploration contribute significantly to the development of novel drugs and therapies.
| CAS Number | 728919-94-6 |
| Molecular Formula | C25H20F3NO4 |
| Purity | ≥95% |
| IUPAC Name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(trifluoromethyl)phenyl]propanoic acid |
| InChI | InChI=1S/C25H20F3NO4/c26-25(27,28)16-11-9-15(10-12-16)22(13-23(30)31)29-24(32)33-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21-22H,13-14H2,(H,29,32)(H,30,31) |
| InChIKey | CUOIPSCYWJDJNE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC(=O)O)C4=CC=C(C=C4)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |