For research use only. Not for therapeutic Use.
3-(5-Nitro-2-thiophene)acrylic Acid is a valuable compound in organic synthesis and materials science. This acrylic acid derivative features a nitro-substituted thiophene ring, contributing to its unique chemical properties. It is often utilized in the development of functional materials, including polymers and dyes, due to its ability to undergo various reactions such as Michael additions and polymerizations. Additionally, its potential biological activity makes it a candidate for further research in medicinal chemistry, particularly in the design of novel therapeutic agents.
CAS Number | 17163-22-3 |
Synonyms | 5-Nitro-2-thiopheneacrylic Acid; 3-(5-Nitro-2-thienyl)-2-propenoic Acid; NSC 178900 |
Molecular Formula | C7H5NO4S |
Purity | ≥95% |
Storage | Store at +4 ℃ |
InChI | InChI=1S/C7H5NO4S/c9-7(10)4-2-5-1-3-6(13-5)8(11)12/h1-4H,(H,9,10)/b4-2+ |
InChIKey | IIJCRPJUZLOCIE-DUXPYHPUSA-N |
SMILES | C1=C(SC(=C1)[N+](=O)[O-])C=CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |