For research use only. Not for therapeutic Use.
3-(4-Pyridyl)acrylic acid is a conjugated compound featuring a pyridine ring attached to an acrylic acid moiety, widely used in pharmaceutical and materials science research. Its unique structure allows it to act as a versatile building block in synthesizing biologically active compounds, especially those targeting cellular receptors and enzymes. With conjugated double bonds and a carboxylic acid group, it is also valuable in studying coordination chemistry and metal-organic frameworks. Its stability and reactivity make it ideal for drug discovery and functional material applications.
| CAS Number | 84228-93-3 |
| Molecular Formula | C8H7NO2 |
| Purity | ≥95% |
| IUPAC Name | (E)-3-pyridin-4-ylprop-2-enoic acid |
| InChI | InChI=1S/C8H7NO2/c10-8(11)2-1-7-3-5-9-6-4-7/h1-6H,(H,10,11)/b2-1+ |
| InChIKey | SSAYTINUCCRGDR-OWOJBTEDSA-N |
| SMILES | C1=CN=CC=C1/C=C/C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |