For research use only. Not for therapeutic Use.
3-(4-Methyl-1H-pyrazol-1-yl)benzaldehyde(Cat No.:L007411), is a chemical compound represented by the molecular formula C11H10N2O. It is classified as an aldehyde, containing a benzaldehyde group (C6H5CHO) substituted with a 4-methyl-1H-pyrazol-1-yl moiety. This unique structure suggests potential applications in organic synthesis, medicinal chemistry, and materials science. Aldehydes are versatile compounds widely used in chemical reactions, serving as intermediates in the synthesis of pharmaceuticals, fragrances, and fine chemicals.
CAS Number | 1339353-78-4 |
Molecular Formula | C11H10N2O |
Purity | ≥95% |
IUPAC Name | 3-(4-methylpyrazol-1-yl)benzaldehyde |
InChI | InChI=1S/C11H10N2O/c1-9-6-12-13(7-9)11-4-2-3-10(5-11)8-14/h2-8H,1H3 |
InChIKey | UDQJGQWPMSHYNR-UHFFFAOYSA-N |
SMILES | CC1=CN(N=C1)C2=CC=CC(=C2)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |