For research use only. Not for therapeutic Use.
3-(4-Methoxyphenyl)propionic acid (Cat No.: M122936) is an aromatic carboxylic acid featuring a methoxy-substituted phenyl ring attached to a three-carbon propionic acid chain. It is commonly used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and fragrance compounds. The methoxy group at the para-position enhances the molecule’s reactivity and electronic properties, making it suitable for electrophilic aromatic substitution and esterification reactions. Its structure resembles certain nonsteroidal anti-inflammatory drugs (NSAIDs), making it valuable in medicinal chemistry and biological activity screening.
CAS Number | 1929-29-9 |
Molecular Formula | C10H12O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-(4-methoxyphenyl)propanoic acid |
InChI | InChI=1S/C10H12O3/c1-13-9-5-2-8(3-6-9)4-7-10(11)12/h2-3,5-6H,4,7H2,1H3,(H,11,12) |
InChIKey | FIUFLISGGHNPSM-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)CCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |