For research use only. Not for therapeutic Use.
3-(4-Hydroxyphenyl)propyl acetate is an organic compound used in the fragrance and flavor industries. Known for its pleasant, floral aroma, it is a key ingredient in perfumes and cosmetic products. Additionally, this compound finds applications in flavoring food and beverages, providing a sweet, fruity note. Its chemical structure contributes to its stability and desirable sensory properties.
| CAS Number | 80373-18-8 |
| Synonyms | 4-Hydroxybenzenepropanol α-Acetate; 4-Hydroxybenzenepropanol 1-Acetate |
| Molecular Formula | C11H14O3 |
| Purity | ≥95% |
| Storage | Desiccate at +4℃ |
| IUPAC Name | 3-(4-hydroxyphenyl)propyl acetate |
| InChI | InChI=1S/C11H14O3/c1-9(12)14-8-2-3-10-4-6-11(13)7-5-10/h4-7,13H,2-3,8H2,1H3 |
| InChIKey | UARIKUWXCSCJBL-UHFFFAOYSA-N |
| SMILES | CC(=O)OCCCC1=CC=C(C=C1)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
