Methyl p-coumarate（Cat No.:R018829）, also known as Methyl 4-hydroxycinnamate, is an ester derived from p-coumaric acid found in Trixis michuacana var longifolia flowers. It exhibits inhibitory effects on melanin formation in B16 mouse melanoma cells. Moreover, Methyl p-coumarate displays potent in vitro inhibitory activity against various pathogens, including Alternaria. This compound holds potential as a natural inhibitor of melanin synthesis and as an antimicrobial agent against pathogenic microorganisms.
| Catalog Number | R018829 |
| CAS Number | 3943-97-3 |
| Synonyms | 4-Hydroxycinnamic Acid Methyl Ester; Methyl 3-(4-Hydroxyphenyl)acrylate; Methyl 4-Coumarate; Methyl 4-Hydroxycinnamate; Methyl p-Coumarate; Methyl p-Hydroxycinnamate; NSC 154578; p-Coumaric Acid Methyl Ester; p-Hydroxycinnamic Acid Methyl Ester |
| Molecular Formula | C10H10O3 |
| Purity | 95% |
| Storage | RT |
| IUPAC Name | methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| InChI | InChI=1S/C10H10O3/c1-13-10(12)7-4-8-2-5-9(11)6-3-8/h2-7,11H,1H3/b7-4+ |
| InChIKey | NITWSHWHQAQBAW-QPJJXVBHSA-N |
| SMILES | COC(=O)C=CC1=CC=C(C=C1)O |
