For research use only. Not for therapeutic Use.
3-(4-Chlorobenzal)phthalide is a chemical compound featuring a phthalide core with a 4-chlorobenzal substitution, commonly used in organic synthesis and medicinal chemistry. This compound serves as an intermediate in the production of pharmaceuticals and fine chemicals, contributing to the development of active pharmaceutical ingredients (APIs) and bioactive molecules. Its unique structural properties make it valuable in various synthetic pathways, particularly for the creation of compounds with potential therapeutic applications. Researchers utilize 3-(4-Chlorobenzal)phthalide in drug discovery and chemical research to explore new pharmacological activities and improve drug efficacy.
| CAS Number | 20526-97-0 |
| Synonyms | 3-[(4-Chlorophenyl)methylene]-1(3H)-isobenzofuranone; 3-(p-Chlorobenzylidene)phthalide; |
| Molecular Formula | C₁₅H₉ClO₂ |
| Purity | ≥95% |
| Storage | -20 ℃ |
| InChI | InChI=1S/C15H9ClO2/c16-11-7-5-10(6-8-11)9-14-12-3-1-2-4-13(12)15(17)18-14/h1-9H/b14-9- |
| InChIKey | OHRFHJYUEWVXBD-ZROIWOOFSA-N |
| SMILES | C1=CC=C2C(=C1)/C(=C/C3=CC=C(C=C3)Cl)/OC2=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |