For research use only. Not for therapeutic Use.
3-[3-Hydroxypropyl(methyl)amino]propan-1-o(Cat No.:L006741). It features a propan-1-ol backbone with a hydroxypropyl(methyl)amino group, making it a versatile compound used in the synthesis of various pharmaceuticals and organic intermediates. This compound is valuable in medicinal chemistry, often used as a building block for designing molecules with specific biological activities. Its structure allows for the creation of diverse derivatives, enabling researchers to explore potential drug candidates.
CAS Number | 2158-67-0 |
Molecular Formula | C7H17NO2 |
Purity | ≥95% |
IUPAC Name | 3-[3-hydroxypropyl(methyl)amino]propan-1-ol |
InChI | InChI=1S/C7H17NO2/c1-8(4-2-6-9)5-3-7-10/h9-10H,2-7H2,1H3 |
InChIKey | PZWOAAMXFPKLPM-UHFFFAOYSA-N |
SMILES | CN(CCCO)CCCO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |