Home
>
Reference Standards> 3-(2'-(spiro-5-chloroadamantane))-4-methoxy-4-(3''-phosphoryloxy)phenyl-1,2-dioxetane
For research use only. Not for therapeutic Use.
The compound 3-(2′-(spiro-5-chloroadamantane))-4-methoxy-4-(3”-phosphoryloxy)phenyl-1,2-dioxetane(Cat No.:M101510) is a complex organic molecule. It features a 1,2-dioxetane core, a four-membered ring containing two oxygen atoms, indicative of its potential use in chemiluminescent applications. Attached to this core is a phenyl ring, substituted with both a methoxy group and a phosphoryloxy group, enhancing its reactive properties. The structure includes a spiro linkage to a 5-chloroadamantane, a bulky, chlorine-substituted cage-like structure that contributes to the molecule’s stability and reactivity. This compound is likely studied for its unique chemical behavior and potential in biochemical applications.
| CAS Number | 142456-88-0 |
| Synonyms | 3-(2′-(spiro-5-chloroadamantane))-4-methoxy-4-(3”-phosphoryloxy)phenyl-1,2-dioxetane |
| Molecular Formula | C18H22ClO7P |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | [3-(1-chloro-3'-methoxyspiro[adamantane-4,4'-dioxetane]-3'-yl)phenyl] dihydrogen phosphate |
| InChI | InChI=1S/C18H22ClO7P/c1-23-18(12-3-2-4-15(7-12)24-27(20,21)22)17(25-26-18)13-5-11-6-14(17)10-16(19,8-11)9-13/h2-4,7,11,13-14H,5-6,8-10H2,1H3,(H2,20,21,22) |
| InChIKey | QWXOJIDBSHLIFI-UHFFFAOYSA-N |
| SMILES | COC1(C2(C3CC4CC2CC(C4)(C3)Cl)OO1)C5=CC(=CC=C5)OP(=O)(O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |