For research use only. Not for therapeutic Use.
3-(2-Phenyl-1H-indol-3-yl)propanoic acid is an organic compound notable for its potential in pharmaceutical research. Its structure includes an indole ring, making it a valuable intermediate in the synthesis of various biologically active molecules. Researchers study this compound for its potential therapeutic properties, including anti-inflammatory and anticancer activities, contributing to the development of new medications and treatments.
CAS Number | 62663-27-8 |
Molecular Formula | C17H15NO2 |
Purity | ≥95% |
IUPAC Name | 3-(2-phenyl-1H-indol-3-yl)propanoic acid |
InChI | InChI=1S/C17H15NO2/c19-16(20)11-10-14-13-8-4-5-9-15(13)18-17(14)12-6-2-1-3-7-12/h1-9,18H,10-11H2,(H,19,20) |
InChIKey | HLMMIHTXAONNJG-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3N2)CCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |